KhyronR752514 KhyronR752514

28-10-2022
Mathematics

contestada

Find each percent change. Round to the nearest tenth of a percent. State if it is an increase or decreasefrom 81 to 91

Respuesta :

HagarL443888 HagarL443888

28-10-2022

The change from 81 to 91 is

91 - 81 = 10

It is an increase since the difference is positive.

The percentage change is

10/81 * 100

= 12.345679

Rounding to the nearest tenth, it becomes 12.3 %

Answer Link

Otras preguntas

Consider the molecule, "SeF2." Which of the following is true Because SeF2 contains polar bonds it must be a polar molecule Because SeF2 contains polar bonds, i

The following figure shows the path of a projectile from left to right. Points A, B, C, and D represent the projectile at different locations along its path. Co

help meeeeeeeeeeeeeeeeeeeeeeeeeeee pleaseeeeeeeeeeeeeeee!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!help meeeeeeeeeeeeeeeeeeeeeeeeeeee pleaseeeeeeeeeeeeeeee!!!!!!!!!!!!!!!!!!

Which activity is an example of biotechnology? A) Bacteria in the soil secreting an antibiotic to kill competitors B) A microbiologist using the microscope to s

A lot of people do a lot of things for us in our everyday life, but we often take for granted what they do for us and do not value it or show our appreciation f

Identify the expected major product of the following reaction. [tex]\underset{\mathrm{H}_3 \mathrm{O}^{+}}{\longrightarrow}[/tex] ?CC(C)C(C)(O)COCC(O)C(C)(C)OCC

Assuming that when the balloon ascends, the temperature does not change, why does the balloon containing helium burst? What law is fulfilled?

two numbers have the sum of 24, and 3 times the first number minus the second number is equal to 12. what are the two numbers

At a movie premiere, the moviegoers were asked whether they liked or did not like the movie. Of the 20 adults asked, 15 said they liked it. Of the 50 teenagers

If a Grid represents 1 whole. Shade the grid to model 0.3