canalesciara04ot30r9 canalesciara04ot30r9

28-07-2017
Mathematics

contestada

Find the sum of 5m + 3n + p, -5p + 3n, and 2n - m

Respuesta :

choixongdong choixongdong

28-07-2017

5m + 3n + p -5p + 3n + 2n - m
= 4m + 8n - 4p (combine like terms)

hope it helps

Answer Link

Trinnnn Trinnnn

28-07-2017

The sum equals 4m+8m-4p

Answer Link

Otras preguntas

Q3.1. Which of the following statements about good experiments is TRUE? A good experiment includes systematic variation for one or more hypothesized causal fact

A regular hexagon and a regular pentagon have the same perimeter. All measurements are given in centimetres. The hexagon has a side length given by 7m +3. The p

Identify the expected major product of the following reaction. [tex]\underset{\mathrm{H}_3 \mathrm{O}^{+}}{\longrightarrow}[/tex] ?CC(C)C(C)(O)COCC(O)C(C)(C)OCC

make x the subject of the formula y=ax2+b

Diarrhea is a potential side effect of which botanical supplement? A. Ginseng B. Echinacea C. â€¢ Saw palmetto D. Ginkgo biloba

If sound takes 12.5 seconds to go from the bottom of a ship to the ocean floor and back, how deep is that part of the ocean?

A sample of bacteria is decaying according to a half-life model. If the sample begins with 800 bacteria, and after 18 minutes there are 240 bacteria, after how

In a cricket match, Kumble took three wickets less than twice the number of wickets taken by Srinath. The product of the number of wickets taken by these two is

Type the number only into each blank for the answer, no other symbols, Round to the tenth's place, if needed. number of sides = sum of interior angles = ? Degre

Which of the following is true about distillation boiling point determination? More than one answer may be correct.Keep boiling the sample until there is nothin